| Product Name | 1-Phenylpyrrolidine |
| CAS No. | 4096-21-3 |
| Synonyms | 1-phenyl-pyrrolidine |
| InChI | InChI=1/C10H13N/c1-2-6-10(7-3-1)11-8-4-5-9-11/h1-3,6-7H,4-5,8-9H2 |
| Molecular Formula | C10H13N |
| Molecular Weight | 147.2169 |
| Density | 1.022g/cm3 |
| Boiling point | 237.8°C at 760 mmHg |
| Flash point | 89°C |
| Refractive index | 1.558 |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; |
4096-21-3 1-phenylpyrrolidine
service@apichina.com