| Product Name | 1-phenylpiperazine dihydrochloride |
| CAS No. | 4004-95-9 |
| Synonyms | 1-Phenylpiperazine dihydrochloride; 1-Phenylpiperazine HCl |
| InChI | InChI=1/C10H14N2.2ClH/c1-2-4-10(5-3-1)12-8-6-11-7-9-12;;/h1-5,11H,6-9H2;2*1H |
| Molecular Formula | C10H16Cl2N2 |
| Molecular Weight | 235.1534 |
| Boiling point | 287.2°C at 760 mmHg |
| Flash point | 138.3°C |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4004-95-9 1-phenylpiperazine dihydrochloride
service@apichina.com