| Product Name | 1-phenylisatin |
| CAS No. | 723-89-7 |
| Synonyms | 1H-Indole-2,3-dione, 1-phenyl- (9CI); 1-Phenyl-1H-indole-2,3-dione; 1-Phenyl-indole-2,3-dione; 1-Phenylisatin; 5-21-10-00247 (Beilstein Handbook Reference); BRN 0164531; NSC 100013; Indole-2,3-dione, 1-phenyl- |
| InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)15(14(13)17)10-6-2-1-3-7-10/h1-9H |
| Molecular Formula | C14H9NO2 |
| Molecular Weight | 223.2268 |
| Density | 1.338g/cm3 |
| Melting point | 138-140℃ |
| Boiling point | 388.8°C at 760 mmHg |
| Flash point | 182.6°C |
| Refractive index | 1.667 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
723-89-7 1-phenylisatin
service@apichina.com