| Product Name | 1-phenyl-1H-pyrazole-5-carboxylic acid |
| CAS No. | 1133-77-3 |
| InChI | InChI=1/C10H8N2O2/c13-10(14)9-6-7-11-12(9)8-4-2-1-3-5-8/h1-7H,(H,13,14) |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.1827 |
| Density | 1.28g/cm3 |
| Melting point | 183℃ |
| Boiling point | 379.6°C at 760 mmHg |
| Flash point | 183.4°C |
| Refractive index | 1.631 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
1133-77-3 1-phenyl-1h-pyrazole-5-carboxylic acid
service@apichina.com