| Product Name | 1-Phenyl-1-cyclopropanecarbonitrile |
| CAS No. | 935-44-4 |
| Synonyms | 1-Phenylcyclopropanecarbonitrile |
| InChI | InChI=1/C10H9N/c11-8-10(6-7-10)9-4-2-1-3-5-9/h1-5H,6-7H2 |
| Molecular Formula | C10H9N |
| Molecular Weight | 143.1852 |
| Density | 1.09g/cm3 |
| Boiling point | 238.5°C at 760 mmHg |
| Flash point | 99°C |
| Refractive index | 1.571 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S24/25:Avoid contact with skin and eyes.; |
935-44-4 1-phenyl-1-cyclopropanecarbonitrile
service@apichina.com