| Product Name | 1-Phenyl-1,2,3-butanetrione 2-oxime |
| CAS No. | 6797-44-0 |
| Synonyms | IBA~Isonitrosobenzoylacetone; 1-phenylbutane-1,2,3-trione 2-oxime; (2E)-2-(hydroxyimino)-1-phenylbutane-1,3-dione |
| InChI | InChI=1/C10H9NO3/c1-7(12)9(11-14)10(13)8-5-3-2-4-6-8/h2-6,14H,1H3/b11-9+ |
| Molecular Formula | C10H9NO3 |
| Molecular Weight | 191.1834 |
| Density | 1.189g/cm3 |
| Boiling point | 357.149°C at 760 mmHg |
| Flash point | 169.798°C |
| Refractive index | 1.554 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6797-44-0 1-phenyl-1,2,3-butanetrione 2-oxime
service@apichina.com