| Product Name | 1-Octen-3-one |
| CAS No. | 4312-99-6 |
| Synonyms | n-Amyl vinyl ketone~n-Pentyl vinyl ketone; oct-1-en-3-one |
| InChI | InChI=1/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3 |
| Molecular Formula | C8H14O |
| Molecular Weight | 126.1962 |
| Density | 0.825g/cm3 |
| Boiling point | 177°C at 760 mmHg |
| Flash point | 58.5°C |
| Refractive index | 1.422 |
| Risk Codes | R10:Flammable.; R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
4312-99-6 1-octen-3-one
service@apichina.com