| Product Name | 1-Naphthylmagnesium bromide |
| CAS No. | 703-55-9 |
| Synonyms | 1-Naphthylmagnesiumbromide (6CI); Magnesium, bromo-1-naphthyl- (7CI,8CI); 1-Naphthalenylmagnesiumbromide; 1-Naphthomagnesium bromide; a-Naphthylmagnesium bromide; Magnesium, bromo-1-naphthalenyl-; magnesium bromide naphthalen-1-ide (1:1:1) |
| InChI | InChI=1/C10H7.BrH.Mg/c1-2-6-10-8-4-3-7-9(10)5-1;;/h1-7H;1H;/q-1;;+2/p-1 |
| Molecular Formula | C10H7BrMg |
| Molecular Weight | 231.3716 |
| Boiling point | 221.5°C at 760 mmHg |
| Flash point | 78.9°C |
| Hazard Symbols | |
| Risk Codes | R11:Highly flammable.; R14:Reacts violently with water.; R19:May form explosive peroxides.; R22:Harmful if swallowed.; R34:Causes burns.; |
| Safety | S16:Keep away from sources of ignition.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S33:Take precautionary measures against static discharges.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident or if you feel unwell, seek medical advice immediately (show the label whenever possible.) ; |
703-55-9 1-naphthylmagnesium bromide
service@apichina.com