| Product Name | 1-Naphthyl propionate |
| CAS No. | 3121-71-9 |
| Synonyms | 1-Naphthalenol, propanoate; AI3-18247; NSC 408079; naphthalen-1-yl propanoate |
| InChI | InChI=1/C13H12O2/c1-2-13(14)15-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| Molecular Formula | C13H12O2 |
| Molecular Weight | 200.2332 |
| Density | 1.126g/cm3 |
| Melting point | 34℃ |
| Boiling point | 312.4°C at 760 mmHg |
| Flash point | 113.8°C |
| Refractive index | 1.591 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
3121-71-9 1-naphthyl propionate
service@apichina.com