| Product Name | 1-Naphthaleneboronic acid neopentyl glycol cyclic ester |
| CAS No. | 22871-77-8 |
| Synonyms | 5,5-dimethyl-2-naphthalen-1-yl-1,3,2-dioxaborinane |
| InChI | InChI=1/C15H17BO2/c1-15(2)10-17-16(18-11-15)14-9-5-7-12-6-3-4-8-13(12)14/h3-9H,10-11H2,1-2H3 |
| Molecular Formula | C15H17BO2 |
| Molecular Weight | 240.1053 |
| Density | 1.08g/cm3 |
| Boiling point | 387.6°C at 760 mmHg |
| Flash point | 188.2°C |
| Refractive index | 1.565 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
22871-77-8 1-naphthaleneboronic acid neopentyl glycol cyclic ester
service@apichina.com