| Product Name | 1-Naphthaleneacethydrazide |
| CAS No. | 34800-90-3 |
| Synonyms | AKOS BBB/161; AKOS AU36-M591; 2-NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-NAPHTHYL)ACETOHYDRAZIDE; ASISCHEM D13399; NAPHTHALEN-1-YL-ACETIC ACID HYDRAZIDE; 2-(1-Naphthyl)acethydrazide; 2-(naphthalen-1-yl)acetohydrazide |
| InChI | InChI=1/C12H12N2O/c13-14-12(15)8-10-6-3-5-9-4-1-2-7-11(9)10/h1-7H,8,13H2,(H,14,15) |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.2365 |
| Density | 1.206g/cm3 |
| Boiling point | 466.4°C at 760 mmHg |
| Flash point | 235.9°C |
| Refractive index | 1.653 |
| Hazard Symbols |  Xi:; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
34800-90-3 1-naphthaleneacethydrazide
service@apichina.com