| Sales Email | Service@apichina.com |
| CAS No. | 14109-72-9 |
| Product Name | 1-Methylthio-2-propanone |
| Synonyms | 1-(Methylsulfanyl)acetone; 1-(methylthio)acetone; 1-METHYLTHIO-2-PROPANONE; 2-propanone, 1-(methylthio)-; 1-(methylsulfanyl)propan-2-one; 1-Methylthio propanone |
| InChI | InChI=1/C4H8OS/c1-4(5)3-6-2/h3H2,1-2H3 |
| Molecular Formula | C4H8OS |
| Molecular Weight | 104.1707 |
| Density | 0.985g/cm3 |
| Boiling point | 144°C at 760 mmHg |
| Flash point | 42.8°C |
| Refractive index | 1.453 |
| Risk Codes | R10:Flammable.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
