| Product Name | 1-Methylbenzotriazole |
| CAS No. | 13351-73-0 |
| Synonyms | 1H-Benzotriazole, 1-methyl-; 1-Methyl-1,2,3-benzotriazole; 4-26-00-00095 (Beilstein Handbook Reference); BRN 0118900; NSC 11743; 1-Methyl-1H-benzotriazole |
| InChI | InChI=1/C7H7N3/c1-10-7-5-3-2-4-6(7)8-9-10/h2-5H,1H3 |
| Molecular Formula | C7H7N3 |
| Molecular Weight | 133.1506 |
| Density | 1.24g/cm3 |
| Boiling point | 270.5°C at 760 mmHg |
| Flash point | 117.4°C |
| Refractive index | 1.658 |
| Safety | S22:Do not inhale dust.; S24/25:Avoid contact with skin and eyes.; |
13351-73-0 1-methylbenzotriazole
service@apichina.com