| Product Name | 1-Methyladenine |
| CAS No. | 5142-22-3 |
| Synonyms | 6H-Purin-6-imine, 1,9-dihydro-1-methyl-; Adenine, 1-methyl-; NSC 70896; 1-Methyl-1H-purin-6-amine; 1H-Purin-6-amine, 1-methyl- (9CI); 1-methyl-1,7-dihydro-6H-purin-6-imine |
| InChI | InChI=1/C6H7N5/c1-11-3-10-6-4(5(11)7)8-2-9-6/h2-3,7H,1H3,(H,8,9) |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.1533 |
| Density | 1.607g/cm3 |
| Melting point | 300℃ |
| Boiling point | 415.879°C at 760 mmHg |
| Flash point | 205.317°C |
| Refractive index | 1.807 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5142-22-3 1-methyladenine
service@apichina.com