| Product Name | 1-Methyl-5-nitroindazole |
| CAS No. | 5228-49-9 |
| Synonyms | 1-methyl-5-nitro-1H-indazole |
| InChI | InChI=1/C8H7N3O2/c1-10-8-3-2-7(11(12)13)4-6(8)5-9-10/h2-5H,1H3 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.1601 |
| Density | 1.425g/cm3 |
| Boiling point | 332.863°C at 760 mmHg |
| Flash point | 155.11°C |
| Refractive index | 1.677 |
| Risk Codes | R20/22:Harmful by inhalation and if swallowed.; |
| Safety | S22:Do not inhale dust.; S36/37:Wear suitable protective clothing and gloves.; |
5228-49-9 1-methyl-5-nitroindazole
service@apichina.com