| Product Name | 1-Methyl-2-pyrroleacetonitrile |
| CAS No. | 24437-41-0 |
| Synonyms | 1-Methylpyrrole-2-acetonitrile; N-methylpyrrol-2-ylacetonitrile; (1-methyl-1H-pyrrol-2-yl)acetonitrile; 1-Methyl-1H-pyrrole-2-acetonitrile |
| InChI | InChI=1/C7H8N2/c1-9-6-2-3-7(9)4-5-8/h2-3,6H,4H2,1H3 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.1518 |
| Density | 0.97g/cm3 |
| Melting point | 20℃ |
| Boiling point | 239.8°C at 760 mmHg |
| Flash point | 98.9°C |
| Refractive index | 1.528 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R22:Harmful if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
24437-41-0 1-methyl-2-pyrroleacetonitrile
service@apichina.com