| Product Name | 1-methyl-1H-imidazole-5-carbohydrazide |
| CAS No. | 23585-00-4 |
| InChI | InChI=1/C5H8N4O/c1-9-3-7-2-4(9)5(10)8-6/h2-3H,6H2,1H3,(H,8,10) |
| Molecular Formula | C5H8N4O |
| Molecular Weight | 140.1432 |
| Density | 1.43g/cm3 |
| Melting point | 186℃ |
| Refractive index | 1.65 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
23585-00-4 1-methyl-1h-imidazole-5-carbohydrazide
service@apichina.com