| Product Name | 1-Methyl-1H-imidazol-5-yl isocyanate |
| CAS No. | 499770-99-9 |
| Synonyms | 5-isocyanato-1-methyl-1H-imidazole |
| InChI | InChI=1/C5H5N3O/c1-8-3-6-2-5(8)7-4-9/h2-3H,1H3 |
| Molecular Formula | C5H5N3O |
| Molecular Weight | 123.1127 |
| Density | 1.22g/cm3 |
| Melting point | 40.5℃ |
| Boiling point | 263.1°C at 760 mmHg |
| Flash point | 112.9°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
499770-99-9 1-methyl-1h-imidazol-5-yl isocyanate
service@apichina.com