| Product Name | 1-Methyl-1H-1,2,3-benzotriazole-5-carbaldehyde |
| CAS No. | 499770-67-1 |
| Synonyms | 1-methyl-1H-benzo[d][1,2,3]triazole-5-carbaldehyde; 1-methylbenzotriazole-5-carbaldehyde |
| InChI | InChI=1/C8H7N3O/c1-11-8-3-2-6(5-12)4-7(8)9-10-11/h2-5H,1H3 |
| Molecular Formula | C8H7N3O |
| Molecular Weight | 161.1607 |
| Density | 1.333g/cm3 |
| Melting point | 159℃ |
| Boiling point | 354.124°C at 760 mmHg |
| Flash point | 167.968°C |
| Refractive index | 1.668 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
499770-67-1 1-methyl-1h-1,2,3-benzotriazole-5-carbaldehyde
service@apichina.com