| Product Name | (1-Methyl-1H-1,2,3-benzotriazol-5-yl)methylamine |
| CAS No. | 499770-77-3 |
| Synonyms | 1-(1-methyl-1H-benzotriazol-5-yl)methanamine |
| InChI | InChI=1/C8H10N4/c1-12-8-3-2-6(5-9)4-7(8)10-11-12/h2-4H,5,9H2,1H3 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.1918 |
| Density | 1.34g/cm3 |
| Melting point | 63℃ |
| Boiling point | 350.7°C at 760 mmHg |
| Flash point | 165.9°C |
| Refractive index | 1.691 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R20:Harmful by inhalation.; R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
499770-77-3 (1-methyl-1h-1,2,3-benzotriazol-5-yl)methylamine
service@apichina.com