| Product Name | 1-Methoxy-2-indanol |
| CAS No. | 56175-44-1 |
| Synonyms | 1H-Inden-2-ol, 2,3-dihydro-1-methoxy-, cis-; 1-methoxy-2,3-dihydro-1H-inden-2-ol; (1S,2S)-1-methoxy-2,3-dihydro-1H-inden-2-ol; (1R,2S)-1-methoxy-2,3-dihydro-1H-inden-2-ol; (1R,2R)-1-methoxy-2,3-dihydro-1H-inden-2-ol; (1S,2R)-1-methoxy-2,3-dihydro-1H-inden-2-ol |
| InChI | InChI=1/C10H12O2/c1-12-10-8-5-3-2-4-7(8)6-9(10)11/h2-5,9-11H,6H2,1H3/t9-,10+/m1/s1 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.2011 |
| Density | 1.15g/cm3 |
| Boiling point | 276.3°C at 760 mmHg |
| Flash point | 122°C |
| Refractive index | 1.569 |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R21/22:Harmful in contact with skin and if swallowed.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
56175-44-1 1-methoxy-2-indanol
service@apichina.com