| Product Name | 1-isoquinolinylmethanol |
| CAS No. | 27311-63-3 |
| Synonyms | isoquinolin-1-ylmethanol |
| InChI | InChI=1/C10H9NO/c12-7-10-9-4-2-1-3-8(9)5-6-11-10/h1-6,12H,7H2 |
| Molecular Formula | C10H9NO |
| Molecular Weight | 159.1846 |
| Density | 1.218g/cm3 |
| Melting point | 80℃ |
| Boiling point | 335.1°C at 760 mmHg |
| Flash point | 156.5°C |
| Refractive index | 1.667 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
27311-63-3 1-isoquinolinylmethanol
service@apichina.com