| Product Name | 1-isoquinolinyl phenyl ketone |
| CAS No. | 16576-23-1 |
| Synonyms | 1-Benzoylisoquinoline; isoquinolin-1-yl(phenyl)methanone |
| InChI | InChI=1/C16H11NO/c18-16(13-7-2-1-3-8-13)15-14-9-5-4-6-12(14)10-11-17-15/h1-11H |
| Molecular Formula | C16H11NO |
| Molecular Weight | 233.2646 |
| Density | 1.196g/cm3 |
| Melting point | 76-79℃ |
| Boiling point | 418.5°C at 760 mmHg |
| Flash point | 212.9°C |
| Refractive index | 1.66 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
16576-23-1 1-isoquinolinyl phenyl ketone
service@apichina.com