| Product Name | 1-Isopropyl-3-(4-fluorophenyl)indole |
| CAS No. | 93957-49-4 |
| Synonyms | 3-(4-Fluorophenyl)-1-Isopropyl-1H-Indole; N-isopropyl-3-(4-fluorophenyl)-1H-indole; 3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indole; Fluvastatin sodium intermediate F1; 3-(4-Fluorobenzene)-1-(1-methylethyl)-1-H-indole; 3-(4-fluorophenyl)-1-(propan-2-yl)-1H-indole; 3-(4-3-(4-Fluorophenyl)-1-(1-methylethyl)-1H-indol |
| InChI | InChI=1/C17H16FN/c1-12(2)19-11-16(13-7-9-14(18)10-8-13)15-5-3-4-6-17(15)19/h3-12H,1-2H3 |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.314 |
| Density | 1.08g/cm3 |
| Boiling point | 389.6°C at 760 mmHg |
| Flash point | 189.4°C |
| Refractive index | 1.573 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
93957-49-4 1-isopropyl-3-(4-fluorophenyl)indole
service@apichina.com