| Product Name | 1-Iodo-2,4,6-trichlorobenzene |
| CAS No. | 6324-50-1 |
| Synonyms | 2,4,6-Trichloroiodobenzene; 1,3,5-trichloro-2-iodobenzene |
| InChI | InChI=1/C6H2Cl3I/c7-3-1-4(8)6(10)5(9)2-3/h1-2H |
| Molecular Formula | C6H2Cl3I |
| Molecular Weight | 307.3435 |
| Density | 2.085g/cm3 |
| Boiling point | 297.5°C at 760 mmHg |
| Flash point | 133.7°C |
| Refractive index | 1.651 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
6324-50-1 1-iodo-2,4,6-trichlorobenzene
service@apichina.com