| Product Name | 1-(Hydroxymethyl)-5,5-dimethyl hydantoin |
| CAS No. | 116-25-6;27636-82-4 |
| Synonyms | 1-(Hydroxymethyl)-5,5-dimethylhydantoin; 5,5-Dimethyl-1-(hydroxymethyl)hydantoin; 1-(hydroxymethyl)-5,5-dimethylimidazolidine-2,4-dione; 1-Hydroxymethyl-5,5-dimethylhydantoin; 2,4-Imidazolidinedione, (hydroxymethyl)-5,5-dimethyl-; 1-Hydroxymethyl-5,5-Dimethyl Hydantoin |
| InChI | InChI=1/C6H10N2O3/c1-6(2)4(10)7-5(11)8(6)3-9/h9H,3H2,1-2H3,(H,7,10,11) |
| Molecular Formula | C6H10N2O3 |
| Molecular Weight | 158.1552 |
| Density | 1.257g/cm3 |
| Refractive index | 1.493 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
116-25-6;27636-82-4 1-(hydroxymethyl)-5,5-dimethyl hydantoin
service@apichina.com
- Next:116-26-7 safranal
- Previous:116-17-6 triisopropyl phosphite