| Product Name | 1-Hydroxy-9-fluorenone |
| CAS No. | 6344-60-1 |
| Synonyms | 1-Hydroxyfluoren-9-one; 1-hydroxy-9H-fluoren-9-one |
| InChI | InChI=1/C13H8O2/c14-11-7-3-6-9-8-4-1-2-5-10(8)13(15)12(9)11/h1-7,14H |
| Molecular Formula | C13H8O2 |
| Molecular Weight | 196.2014 |
| Density | 1.369g/cm3 |
| Melting point | 116-119℃ |
| Boiling point | 383.4°C at 760 mmHg |
| Flash point | 163.7°C |
| Refractive index | 1.707 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
6344-60-1 1-hydroxy-9-fluorenone
service@apichina.com