| Product Name | 1-Hexyn-3-ol |
| CAS No. | 105-31-7 |
| Synonyms | Ethynyl n-propyl carbinol; hex-1-yn-3-ol; (3S)-hex-1-yn-3-ol; (3R)-hex-1-yn-3-ol |
| InChI | InChI=1/C6H10O/c1-3-5-6(7)4-2/h2,6-7H,3,5H2,1H3/t6-/m0/s1 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.143 |
| Density | 0.898g/cm3 |
| Boiling point | 140.3°C at 760 mmHg |
| Flash point | 42.7°C |
| Refractive index | 1.446 |
| Risk Codes | R10:Flammable.; R25:Toxic if swallowed.; R27:Very toxic in contact with skin.; |
| Safety | S28:After contact with skin, wash immediately with plenty of ...; S36/37:Wear suitable protective clothing and gloves.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
105-31-7 1-hexyn-3-ol
service@apichina.com