| Product Name | 1-Hexen-3-one |
| CAS No. | 1629-60-3 |
| Synonyms | n-Propyl vinyl ketone; hex-1-en-3-one |
| InChI | InChI=1/C6H10O/c1-3-5-6(7)4-2/h4H,2-3,5H2,1H3 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.143 |
| Density | 0.819g/cm3 |
| Boiling point | 130°C at 760 mmHg |
| Flash point | 28.5°C |
| Refractive index | 1.408 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1629-60-3 1-hexen-3-one
service@apichina.com