| Product Name | 1-Ethyl-3-methyl-4-piperidone |
| CAS No. | 3612-16-6 |
| Synonyms | 1-ethyl-3-methylpiperidin-4-one |
| InChI | InChI=1/C8H15NO/c1-3-9-5-4-8(10)7(2)6-9/h7H,3-6H2,1-2H3 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.2108 |
| Density | 0.931g/cm3 |
| Boiling point | 212.3°C at 760 mmHg |
| Flash point | 76.2°C |
| Refractive index | 1.45 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
3612-16-6 1-ethyl-3-methyl-4-piperidone
service@apichina.com