| Product Name | 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol |
| CAS No. | 15217-53-5 |
| Synonyms | 1-Ethyl-5-mercaptotetrazole; 1-ETHYL-5-MERCAPTO-1H-TETRAZOLE; 1-ETHYL-1H-TETRAZOLE-5-THIOL; 1-ethyl-1,2-dihydro-5h-tetrazole-5-thione; 1-ETHYL-1H-1,2,3,4-TETRAZOLE-5-THIOL; 1-Ethyl-5-mercapto-1,2,3,4-tetrazole; 1-ETHYL-1,4-DIHYDRO-TETRAZOLE-5-THIONE |
| InChI | InChI=1/C3H6N4S/c1-2-7-3(8)4-5-6-7/h2H2,1H3,(H,4,6,8) |
| Molecular Formula | C3H6N4S |
| Molecular Weight | 130.1715 |
| Density | 1.53g/cm3 |
| Boiling point | 136.4°C at 760 mmHg |
| Flash point | 36.3°C |
| Refractive index | 1.737 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
15217-53-5 1-ethyl-1h-1,2,3,4-tetraazole-5-thiol
service@apichina.com