| Product Name | 1-Ethoxynaphthalene |
| CAS No. | 5328-01-8 |
| Synonyms | Ethyl 1-naphthyl ether; Ethyl alpha-naphthyl ether; ; alpha-Ethoxynaphthalene; Naphthalene, 1-ethoxy-; 1-Naphthol ethyl ether; Naphtholethylether |
| InChI | InChI=1/C12H12O/c1-2-13-12-9-5-7-10-6-3-4-8-11(10)12/h3-9H,2H2,1H3 |
| Molecular Formula | C12H12O |
| Molecular Weight | 172.2231 |
| Density | 1.049g/cm3 |
| Boiling point | 280.5°C at 760 mmHg |
| Flash point | 109.4°C |
| Refractive index | 1.59 |
| Safety | S24/25:Avoid contact with skin and eyes.; |
5328-01-8 1-ethoxynaphthalene
service@apichina.com