| Product Name | 1-Dimethylamino-2-nitroethylene |
| CAS No. | 1190-92-7 |
| Synonyms | 1-(dimethylamino)-2-nitroethylene; (E)-N,N-dimethyl-2-nitroethenamine; 1-Nitro-2-(dimethylamino)ethylene |
| InChI | InChI=1/C4H8N2O2/c1-5(2)3-4-6(7)8/h3-4H,1-2H3/b4-3+ |
| Molecular Formula | C4H8N2O2 |
| Molecular Weight | 116.1185 |
| Density | 1.073g/cm3 |
| Boiling point | 161.1°C at 760 mmHg |
| Flash point | 51.2°C |
| Refractive index | 1.473 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
1190-92-7 1-dimethylamino-2-nitroethylene
service@apichina.com