| Product Name | 1-Diethylamino-2-propanol |
| CAS No. | 4402-32-8 |
| Synonyms | 2-Propanol, 1-(diethylamino)-; 1-(Diethylamino)-2-propanol; NSC 6304; 1-Diethylaminopropan-2-ol; (2R)-N,N-diethyl-2-hydroxypropan-1-aminium; (2S)-N,N-diethyl-2-hydroxypropan-1-aminium; (2S)-1-(diethylamino)propan-2-ol |
| InChI | InChI=1/C7H17NO/c1-4-8(5-2)6-7(3)9/h7,9H,4-6H2,1-3H3/t7-/m0/s1 |
| Molecular Formula | C7H17NO |
| Molecular Weight | 131.216 |
| Density | 0.879g/cm3 |
| Melting point | 13.5℃ |
| Boiling point | 156.5°C at 760 mmHg |
| Flash point | 33.3°C |
| Refractive index | 1.444 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S16:Keep away from sources of ignition - No smoking.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S7:Keep container tightly closed.; |
4402-32-8 1-diethylamino-2-propanol
service@apichina.com