| Product Name | 1-cyclohexen-1-yl acetate |
| CAS No. | 1424-22-2 |
| Synonyms | 1-Acetoxy-1-cyclohexene; 1-cyclohexen-1-ol, acetate; 1-CYCLOHEXENYL ACETATE; Cyclohex-1-en-1-yl acetate; Cyclohexen-1-ol acetate |
| InChI | InChI=1/C8H12O2/c1-7(9)10-8-5-3-2-4-6-8/h5H,2-4,6H2,1H3 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.1797 |
| Density | 1g/cm3 |
| Boiling point | 214.9°C at 760 mmHg |
| Flash point | 79.4°C |
| Refractive index | 1.467 |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S24/25:Avoid contact with skin and eyes.; |
1424-22-2 1-cyclohexen-1-yl acetate
service@apichina.com