| Product Name | 1-Cyano-3-methylisothiourea, sodium salt |
| CAS No. | 67944-71-2 |
| InChI | InChI=1/C3H5N3S/c1-5-3(7)6-2-4/h1H3,(H2,5,6,7)/p-1 |
| Molecular Formula | C3H4N3S |
| Molecular Weight | 114.1495 |
| Melting point | 290℃ |
| Boiling point | 160.5°C at 760 mmHg |
| Flash point | 50.8°C |
| Hazard Symbols |  Xn:Harmful; |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S36/37:Wear suitable protective clothing and gloves.; |
67944-71-2 1-cyano-3-methylisothiourea, sodium salt
service@apichina.com