| Product Name | 1-(Chloromethyl)-4-Ethenylbenzene |
| CAS No. | 1592-20-7;30030-25-2 |
| Synonyms | 4-Chloromethyl styrene; 4-Vinylbenzylchloride; 1-(chloromethyl)-4-ethenyl-benzen; 4-Vinylbenzyl chloride; 1-(Chloromethyl)-4-ethenyl-Benzene; Chloromethyl styrene; 1-(chloromethyl)-3-ethenylbenzene-1-(chloromethyl)-4-ethenylbenzene (1:1); vinylbenzyl chloride, mixture of isomers; Chloromethylstyrene; Chloromethylstyrene (m- and p-mixture) (stabilized with TBC); VBC |
| InChI | InChI=1/C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8/h2-6H,1,7H2 |
| Molecular Formula | C9H9Cl |
| Molecular Weight | 152.62 |
| Density | 1.083 |
| Boiling point | 229℃ |
| Flash point | 105℃ |
| Refractive index | 1.5731-1.5751 |
| Hazard Symbols | |
| Risk Codes | R21/22:; R34:; R43:; |
| Safety | S26:; S36/37/39:; S45:; |
1592-20-7;30030-25-2 1-(chloromethyl)-4-ethenylbenzene
service@apichina.com
- Next:258-57-1 quino[3,2-b]acridine
- Previous:1592-12-7 4-vinylbenzyl acetate