| Product Name | 1-(chloromethyl)-2,4-dimethylbenzene |
| CAS No. | 824-55-5 |
| Synonyms | 2,4-Dimethylbenzyl chloride; 4-(Chloromethyl)-m-xylene; 2,4-Dimethylbenzylchloride |
| InChI | InChI=1/C9H11Cl/c1-7-3-4-9(6-10)8(2)5-7/h3-5H,6H2,1-2H3 |
| Molecular Formula | C9H11Cl |
| Molecular Weight | 154.6366 |
| Density | 1.033g/cm3 |
| Boiling point | 215.5°C at 760 mmHg |
| Flash point | 86.5°C |
| Refractive index | 1.522 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; R36:Irritating to eyes.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).; |
824-55-5 1-(chloromethyl)-2,4-dimethylbenzene
service@apichina.com