| Product Name | 1-chloroanthracene |
| CAS No. | 4985-70-0 |
| Synonyms | 1-Chloroanthracene; CCRIS 5548; NSC 4218; Anthracene, 1-chloro- (8CI)(9CI) |
| InChI | InChI=1/C14H9Cl/c15-14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
| Molecular Formula | C14H9Cl |
| Molecular Weight | 212.6743 |
| Density | 1.253g/cm3 |
| Melting point | 77-80℃ |
| Boiling point | 370.1°C at 760 mmHg |
| Flash point | 179.2°C |
| Refractive index | 1.717 |
4985-70-0 1-chloroanthracene
service@apichina.com