| Product Name | 1-Chloro-6-iodohexane |
| CAS No. | 34683-73-3 |
| Synonyms | Hexamethylene chloroiodide |
| InChI | InChI=1/C6H5ClIN/c7-4-1-2-6(9)5(8)3-4/h1-3H,9H2 |
| Molecular Formula | C6H5ClIN |
| Molecular Weight | 253.4681 |
| Density | 2.015g/cm3 |
| Boiling point | 295°C at 760 mmHg |
| Flash point | 132.2°C |
| Refractive index | 1.694 |
| Risk Codes | R36/38:Irritating to eyes and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
34683-73-3 1-chloro-6-iodohexane
service@apichina.com