| Product Name | 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one |
| CAS No. | 175202-90-1 |
| Synonyms | 1-chloro-6,6-dimethyl-3-(methylsulfanyl)-6,7-dihydro-2-benzothiophen-4(5H)-one |
| InChI | InChI=1/C11H13ClOS2/c1-11(2)4-6-8(7(13)5-11)10(14-3)15-9(6)12/h4-5H2,1-3H3 |
| Molecular Formula | C11H13ClOS2 |
| Molecular Weight | 260.8033 |
| Density | 1.31g/cm3 |
| Melting point | 126℃ |
| Boiling point | 366.5°C at 760 mmHg |
| Flash point | 175.5°C |
| Refractive index | 1.604 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
175202-90-1 1-chloro-6,6-dimethyl-3-(methylthio)-4,5,6,7-tetrahydrobenzo[c]thiophen-4-one
service@apichina.com