| Product Name | 1-Chloro-4-iodo-2,5-dimethoxy-benzene |
| CAS No. | 90064-46-3 |
| Synonyms | 1-Chloro-4-iodo-2,5-dimethoxybenzene |
| InChI | InChI=1/C8H8ClIO2/c1-11-7-4-6(10)8(12-2)3-5(7)9/h3-4H,1-2H3 |
| Molecular Formula | C8H8ClIO2 |
| Molecular Weight | 298.5054 |
| Density | 1.74g/cm3 |
| Melting point | 115℃ |
| Boiling point | 324.8°C at 760 mmHg |
| Flash point | 150.2°C |
| Refractive index | 1.584 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
90064-46-3 1-chloro-4-iodo-2,5-dimethoxy-benzene
service@apichina.com