| Product Name | 1-Chloro-4-(ethylthio)benzene |
| CAS No. | 5120-72-9 |
| Synonyms | 4-Chlorophenyl ethyl sulphide~4-(Ethylthio)chlorobenzene; 1-chloro-4-(ethylsulfanyl)benzene |
| InChI | InChI=1/C8H9ClS/c1-2-10-8-5-3-7(9)4-6-8/h3-6H,2H2,1H3 |
| Molecular Formula | C8H9ClS |
| Molecular Weight | 172.6751 |
| Density | 1.16g/cm3 |
| Boiling point | 240.5°C at 760 mmHg |
| Flash point | 99.3°C |
| Refractive index | 1.574 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
5120-72-9 1-chloro-4-(ethylthio)benzene
service@apichina.com