| Product Name | 1-chloro-4-(3-iodopropoxy)benzene |
| CAS No. | 119795-57-2 |
| InChI | InChI=1/C9H10ClIO/c10-8-2-4-9(5-3-8)12-7-1-6-11/h2-5H,1,6-7H2 |
| Molecular Formula | C9H10ClIO |
| Molecular Weight | 296.5326 |
| Density | 1.673g/cm3 |
| Melting point | 31℃ |
| Boiling point | 317°C at 760 mmHg |
| Flash point | 145.5°C |
| Refractive index | 1.593 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
119795-57-2 1-chloro-4-(3-iodopropoxy)benzene
service@apichina.com