| Product Name | 1-chloro-3-methoxy-2-propanol |
| CAS No. | 4151-97-7 |
| Synonyms | 3-Chloro-1-methoxy-2-propanol; 1-chloro-3-methoxypropan-2-ol |
| InChI | InChI=1/C4H9ClO2/c1-7-3-4(6)2-5/h4,6H,2-3H2,1H3 |
| Molecular Formula | C4H9ClO2 |
| Molecular Weight | 124.5661 |
| Density | 1.13g/cm3 |
| Boiling point | 181.6°C at 760 mmHg |
| Flash point | 63.6°C |
| Refractive index | 1.433 |
| Risk Codes | R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; R36:Irritating to eyes.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.; |
4151-97-7 1-chloro-3-methoxy-2-propanol
service@apichina.com