| Product Name | 1-Chloro-3-fluoro-2-propanol |
| CAS No. | 453-11-2 |
| Synonyms | 1-Chloro-3-fluoroisopropanol; 1-chloro-3-fluoropropan-2-ol |
| InChI | InChI=1/C3H6ClFO/c4-1-3(6)2-5/h3,6H,1-2H2 |
| Molecular Formula | C3H6ClFO |
| Molecular Weight | 112.5305 |
| Density | 1.212g/cm3 |
| Boiling point | 158.1°C at 760 mmHg |
| Flash point | 49.4°C |
| Refractive index | 1.399 |
| Risk Codes | R10:Flammable.; R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.; |
| Safety | S23:Do not inhale gas/fumes/vapour/spray.; S36/37:Wear suitable protective clothing and gloves.; |
453-11-2 1-chloro-3-fluoro-2-propanol
service@apichina.com