| Product Name | 1-Chloro-2,5-diethoxy-4-nitrobenzene |
| CAS No. | 91-43-0 |
| Synonyms | Benzene, 1-chloro-2,5-diethoxy-4-nitro-; 2,5-Diethoxy-4-nitrochlorobenzene; 5-Chloro-2-nitro-p-diethoxybenzene; NSC 60284 |
| InChI | InChI=1/C10H12ClNO4/c1-3-15-9-6-8(12(13)14)10(16-4-2)5-7(9)11/h5-6H,3-4H2,1-2H3 |
| Molecular Formula | C10H12ClNO4 |
| Molecular Weight | 245.6596 |
| Density | 1.264g/cm3 |
| Boiling point | 368.4°C at 760 mmHg |
| Flash point | 176.6°C |
| Refractive index | 1.533 |
| Hazard Symbols |  Xi:Irritant; |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S37/39:Wear suitable gloves and eye/face protection.; |
91-43-0 1-chloro-2,5-diethoxy-4-nitrobenzene
service@apichina.com