| Product Name | 1-Bromohexahydro-2H-azepin-2-one |
| CAS No. | 2439-83-0 |
| Synonyms | N-Bromocaprolactam; 1-bromoazepan-2-one |
| InChI | InChI=1/C6H10BrNO/c7-8-5-3-1-2-4-6(8)9/h1-5H2 |
| Molecular Formula | C6H10BrNO |
| Molecular Weight | 192.0537 |
| Density | 1.522g/cm3 |
| Boiling point | 220.9°C at 760 mmHg |
| Flash point | 87.4°C |
| Refractive index | 1.533 |
| Risk Codes | R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
2439-83-0 1-bromohexahydro-2h-azepin-2-one
service@apichina.com