| Product Name | 1-Bromo-4-methyl-3-hexene |
| CAS No. | 19198-88-0 |
| Synonyms | (3E)-1-bromo-4-methylhex-3-ene |
| InChI | InChI=1/C7H13Br/c1-3-7(2)5-4-6-8/h5H,3-4,6H2,1-2H3/b7-5+ |
| Molecular Formula | C7H13Br |
| Molecular Weight | 177.0821 |
| Density | 1.175g/cm3 |
| Boiling point | 175.6°C at 760 mmHg |
| Flash point | 53.6°C |
| Refractive index | 1.47 |
| Risk Codes | R10:Flammable.; R36/37/38:Irritating to eyes, respiratory system and skin.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S36:Wear suitable protective clothing.; |
19198-88-0 1-bromo-4-methyl-3-hexene
service@apichina.com