| Product Name | 1-Bromo-3,3-diphenylpropane |
| CAS No. | 20017-68-9 |
| Synonyms | 3,3-Diphenylpropyl bromide; 1,1'-(3-bromopropane-1,1-diyl)dibenzene |
| InChI | InChI=1/C15H15Br/c16-12-11-15(13-7-3-1-4-8-13)14-9-5-2-6-10-14/h1-10,15H,11-12H2 |
| Molecular Formula | C15H15Br |
| Molecular Weight | 275.1836 |
| Density | 1.275g/cm3 |
| Melting point | 39-42℃ |
| Boiling point | 317.4°C at 760 mmHg |
| Flash point | 143.2°C |
| Refractive index | 1.587 |
| Hazard Symbols |  C:Corrosive; |
| Risk Codes | R34:Causes burns.; |
| Safety | S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.; S28A:After contact with skin, wash immediately with plenty of water.; |
20017-68-9 1-bromo-3,3-diphenylpropane
service@apichina.com